Difference between revisions of "UBIQUINONE-8"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1124 RXN-1124] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ident...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINONE-8 UBIQUINONE-8] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C(OC)=C(OC)C(=O)C(C)=1)=O) |
+ | * common name: | ||
+ | ** ubiquinone-8 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ICFIZJQGJAJRSU-SGHXUWJISA-N | ||
+ | * molecular weight: | ||
+ | ** 727.121 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ubiquinone(8) | ||
+ | ** coenzyme-Q8 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[NADHor_2m]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * CAS : 1339-63-5 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283546 5283546] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C17569 C17569] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4446659.html 4446659] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61683 61683] | ||
+ | * BIGG : q8 | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C(OC)=C(OC)C(=O)C(C)=1)=O)}} | ||
+ | {{#set: common name=ubiquinone-8}} | ||
+ | {{#set: inchi key=InChIKey=ICFIZJQGJAJRSU-SGHXUWJISA-N}} | ||
+ | {{#set: molecular weight=727.121 }} | ||
+ | {{#set: common name=ubiquinone(8)|coenzyme-Q8}} | ||
+ | {{#set: consumed by=NADHor_2m}} |
Latest revision as of 19:05, 21 March 2018
Contents
Metabolite UBIQUINONE-8
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C(OC)=C(OC)C(=O)C(C)=1)=O)
- common name:
- ubiquinone-8
- inchi key:
- InChIKey=ICFIZJQGJAJRSU-SGHXUWJISA-N
- molecular weight:
- 727.121
- Synonym(s):
- ubiquinone(8)
- coenzyme-Q8
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links