Difference between revisions of "CPD-6947"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6947 CPD-6947] == * smiles: ** CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6947 CPD-6947] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** demethylphylloquinone |
+ | * inchi key: | ||
+ | ** InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 436.676 |
* Synonym(s): | * Synonym(s): | ||
− | ** 2- | + | ** 2-phytyl-1,4-naphtoquinone |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[R06859]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[R06858]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927684 56927684] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10128305.html 10128305] | ||
+ | * HMDB : HMDB04649 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31087 31087] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13309 C13309] |
− | {{#set: | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C}} |
− | {{#set: molecular weight= | + | {{#set: common name=demethylphylloquinone}} |
− | {{#set: common name=2- | + | {{#set: inchi key=InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N}} |
− | {{#set: produced by= | + | {{#set: molecular weight=436.676 }} |
+ | {{#set: common name=2-phytyl-1,4-naphtoquinone}} | ||
+ | {{#set: consumed by=R06859}} | ||
+ | {{#set: produced by=R06858}} |
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite CPD-6947
- smiles:
- CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C
- common name:
- demethylphylloquinone
- inchi key:
- InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N
- molecular weight:
- 436.676
- Synonym(s):
- 2-phytyl-1,4-naphtoquinone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links