Difference between revisions of "7-CYANO-7-DEAZAGUANINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.232-RXN 2.4.1.232-RXN] == * direction: ** REVERSIBLE * common name: ** vacuolar_protein_sorti...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] == * smiles: ** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] == |
− | * | + | * smiles: |
− | ** | + | ** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N) |
* common name: | * common name: | ||
− | ** | + | ** preQ0 |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N |
− | ** | + | * molecular weight: |
+ | ** 175.149 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 7-cyano-7-deazaguanine | ||
+ | ** 7-cyano-7-carbaguanine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12093]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * DRUGBANK : DB03074 | |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=446357 446357] | |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.393739.html 393739] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45075 45075] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15996 C15996] |
+ | {{#set: smiles=C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)}} | ||
+ | {{#set: common name=preQ0}} | ||
+ | {{#set: inchi key=InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=175.149 }} | ||
+ | {{#set: common name=7-cyano-7-deazaguanine|7-cyano-7-carbaguanine}} | ||
+ | {{#set: produced by=RXN-12093}} |
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite 7-CYANO-7-DEAZAGUANINE
- smiles:
- C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)
- common name:
- preQ0
- inchi key:
- InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N
- molecular weight:
- 175.149
- Synonym(s):
- 7-cyano-7-deazaguanine
- 7-cyano-7-carbaguanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links