Difference between revisions of "RXN-10777"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMIDINE SPERMIDINE] == * smiles: ** C([N+])CC[N+]CCCC[N+] * inchi key: ** InChIKey=ATHGHQPFG...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10777 RXN-10777] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMIDINE SPERMIDINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10777 RXN-10777] ==
* smiles:
+
* direction:
** C([N+])CC[N+]CCCC[N+]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=ATHGHQPFGPMSJY-UHFFFAOYSA-Q
+
** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1]
* common name:
+
** spermidine
+
* molecular weight:
+
** 148.271   
+
 
* Synonym(s):
 
* Synonym(s):
** N-(3-aminopropyl)butane-1,4-diamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[SPERMINE-SYNTHASE-RXN]]
+
* With identifiers:
* [[SPMDtmi]]
+
** 1 [[PAPS]][c] '''+''' 1 [[SEROTONIN]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-11665]][c] '''+''' 1 [[3-5-ADP]][c]
* [[RXN-13414]]
+
* With common name(s):
== Reaction(s) known to produce the compound ==
+
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 serotonin[c] '''=>''' 1 H+[c] '''+''' 1 serotonin O-sulfate[c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
* [[APAPT]]
+
 
* [[SPMDtmi]]
+
== Genes associated with this reaction  ==
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
* [[SPERMIDINESYN-RXN]]
+
* Gene: [[Tiso_gene_5505]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6313]], serotonin degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6313 PWY-6313]
 +
** '''6''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 124-20-9
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC57834
+
{{#set: ec number=EC-2.8.2.1}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_5505}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992097 6992097]
+
{{#set: in pathway=PWY-6313}}
* HMDB : HMDB01257
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
** [http://www.genome.jp/dbget-bin/www_bget?C00315 C00315]
+
{{#set: reconstruction tool=pantograph}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5360248.html 5360248]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57834 57834]
+
* BIGG : spmd
+
{{#set: smiles=C([N+])CC[N+]CCCC[N+]}}
+
{{#set: inchi key=InChIKey=ATHGHQPFGPMSJY-UHFFFAOYSA-Q}}
+
{{#set: common name=spermidine}}
+
{{#set: molecular weight=148.271    }}
+
{{#set: common name=N-(3-aminopropyl)butane-1,4-diamine}}
+
{{#set: consumed by=SPERMINE-SYNTHASE-RXN|SPMDtmi|RXN-13414}}
+
{{#set: produced by=APAPT|SPMDtmi}}
+
{{#set: reversible reaction associated=SPERMIDINESYN-RXN}}
+

Latest revision as of 19:09, 21 March 2018

Reaction RXN-10777

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3'-phosphoadenylyl-sulfate[c] + 1 serotonin[c] => 1 H+[c] + 1 serotonin O-sulfate[c] + 1 adenosine 3',5'-bisphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6313, serotonin degradation: PWY-6313
    • 6 reactions found over 7 reactions in the full pathway

Reconstruction information

External links