Difference between revisions of "PWY-5523"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5523 PWY-5523] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5523 PWY-5523] ==
* smiles:
+
* taxonomic range:
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M
+
 
* common name:
 
* common name:
** 3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide
+
** 5,6-dimethylbenzimidazole biosynthesis I (aerobic)
* molecular weight:
+
** 826.095   
+
 
* Synonym(s):
 
* Synonym(s):
** triiodothyronine glucuronide
+
** DMB biosynthesis I
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-
+
** T3G
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
* [[RXN-10607]]
+
* [[RIBOFLAVINKIN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_7479]]
 +
*** [[Tiso_gene_16837]]
 +
*** [[Tiso_gene_1086]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=FMNREDUCT-RXN FMNREDUCT-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8771 RXN-8771]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659063 90659063]
+
{{#set: common name=5,6-dimethylbenzimidazole biosynthesis I (aerobic)}}
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
+
{{#set: common name=DMB biosynthesis I}}
{{#set: inchi key=InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M}}
+
{{#set: reaction found=1}}
{{#set: common name=3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide}}
+
{{#set: total reaction=3}}
{{#set: molecular weight=826.095    }}
+
{{#set: completion rate=33.0}}
{{#set: common name=triiodothyronine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-|T3G}}
+
{{#set: produced by=RXN-10607}}
+

Latest revision as of 19:09, 21 March 2018

Pathway PWY-5523

  • taxonomic range:
  • common name:
    • 5,6-dimethylbenzimidazole biosynthesis I (aerobic)
  • Synonym(s):
    • DMB biosynthesis I

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links