Difference between revisions of "Cis-delta9-3-oxo-montanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * smiles: ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta9-3-oxo-montanoyl-ACPs cis-delta9-3-oxo-montanoyl-ACPs] == * common name: ** a cis-del...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta9-3-oxo-montanoyl-ACPs cis-delta9-3-oxo-montanoyl-ACPs] ==
* smiles:
+
** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
+
* inchi key:
+
** InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
+
 
* common name:
 
* common name:
** cellotetraose
+
** a cis-delta9-3-oxo-C28:1-[acp]
* molecular weight:
+
** 666.583   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12305]]
+
* [[RXN1G-240]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-218]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis-delta9-3-oxo-C28:1-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=170125 170125]
+
{{#set: consumed by=RXN1G-240}}
* CHEMSPIDER:
+
{{#set: produced by=RXN1G-218}}
** [http://www.chemspider.com/Chemical-Structure.148760.html 148760]
+
{{#set: smiles=C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O}}
+
{{#set: inchi key=InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N}}
+
{{#set: common name=cellotetraose}}
+
{{#set: molecular weight=666.583    }}
+
{{#set: consumed by=RXN-12305}}
+

Latest revision as of 19:12, 21 March 2018

Metabolite cis-delta9-3-oxo-montanoyl-ACPs

  • common name:
    • a cis-delta9-3-oxo-C28:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta9-3-oxo-C28:1-[acp" cannot be used as a page name in this wiki.