Difference between revisions of "PWY-5107"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5107 PWY-5107] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5107 PWY-5107] ==
* smiles:
+
* taxonomic range:
** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
* inchi key:
+
** InChIKey=FPWMCUPFBRFMLH-XGAOUMNUSA-L
+
 
* common name:
 
* common name:
** prephenate
+
** phytol salvage pathway
* molecular weight:
+
** 224.17   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** phytyl-PP biosynthesis (from phytol)
 +
** phytyl-diphosphate biosynthesis (from phytol)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[PREPHENATEDEHYDROG-RXN]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-7683]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[PREPHENATEDEHYDRAT-RXN]]
+
*** [[Tiso_gene_14722]]
* [[CHORISMATEMUT-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7763 RXN-7763]
 
== External links  ==
 
== External links  ==
* CAS : 126-49-8
+
* ARACYC:
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5107 PWY-5107]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460303 5460303]
+
{{#set: taxonomic range=TAX-3398}}
* HMDB : HMDB12283
+
{{#set: common name=phytol salvage pathway}}
* LIGAND-CPD:
+
{{#set: common name=phytyl-PP biosynthesis (from phytol)|phytyl-diphosphate biosynthesis (from phytol)}}
** [http://www.genome.jp/dbget-bin/www_bget?C00254 C00254]
+
{{#set: reaction found=1}}
* CHEMSPIDER:
+
{{#set: total reaction=2}}
** [http://www.chemspider.com/Chemical-Structure.4573884.html 4573884]
+
{{#set: completion rate=50.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29934 29934]
+
* BIGG : pphn
+
{{#set: smiles=C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1)}}
+
{{#set: inchi key=InChIKey=FPWMCUPFBRFMLH-XGAOUMNUSA-L}}
+
{{#set: common name=prephenate}}
+
{{#set: molecular weight=224.17    }}
+
{{#set: consumed by=PREPHENATEDEHYDROG-RXN}}
+
{{#set: reversible reaction associated=PREPHENATEDEHYDRAT-RXN|CHORISMATEMUT-RXN}}
+

Latest revision as of 19:13, 21 March 2018

Pathway PWY-5107

  • taxonomic range:
  • common name:
    • phytol salvage pathway
  • Synonym(s):
    • phytyl-PP biosynthesis (from phytol)
    • phytyl-diphosphate biosynthesis (from phytol)

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links