Difference between revisions of "PWY-5107"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5107 PWY-5107] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5107 PWY-5107] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phytol salvage pathway |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** phytyl-PP biosynthesis (from phytol) | ||
+ | ** phytyl-diphosphate biosynthesis (from phytol) | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[RXN-7683]] | |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_14722]] |
− | * [ | + | ** 1 reconstruction source(s) associated: |
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7763 RXN-7763] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5107 PWY-5107] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-3398}} |
− | + | {{#set: common name=phytol salvage pathway}} | |
− | + | {{#set: common name=phytyl-PP biosynthesis (from phytol)|phytyl-diphosphate biosynthesis (from phytol)}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:13, 21 March 2018
Pathway PWY-5107
- taxonomic range:
- common name:
- phytol salvage pathway
- Synonym(s):
- phytyl-PP biosynthesis (from phytol)
- phytyl-diphosphate biosynthesis (from phytol)
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXN-7683
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: