Difference between revisions of "ALCDHi"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDHi ALCDHi] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogenase (ethanol: N...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDHi ALCDHi] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** alcohol dehydrogenase (ethanol: NAD) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[ACETALD]][c] '''+''' 1.0 [[NADH]][c] '''+''' 1.0 [[PROTON]][c] '''=>''' 1.0 [[ETOH]][c] '''+''' 1.0 [[NAD]][c] |
| − | == | + | * With common name(s): |
| + | ** 1.0 acetaldehyde[c] '''+''' 1.0 NADH[c] '''+''' 1.0 H+[c] '''=>''' 1.0 ethanol[c] '''+''' 1.0 NAD+[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_2052]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=alcohol dehydrogenase (ethanol: NAD)}} | |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_2052}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
Latest revision as of 19:16, 21 March 2018
Contents
Reaction ALCDHi
- direction:
- LEFT-TO-RIGHT
- common name:
- alcohol dehydrogenase (ethanol: NAD)
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 acetaldehyde[c] + 1.0 NADH[c] + 1.0 H+[c] => 1.0 ethanol[c] + 1.0 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2052
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
