Difference between revisions of "CPD-8646"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9537 RXN-9537] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase * ec numb...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4)))) |
* common name: | * common name: | ||
− | ** | + | ** 7-dehydrodesmosterol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 382.628 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5α-cholesta-5,7,24-trien-3β-ol |
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-27]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-26]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440558 440558] | |
− | + | * HMDB : HMDB03896 | |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107] |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}} |
− | {{#set: | + | {{#set: common name=7-dehydrodesmosterol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}} |
− | {{#set: | + | {{#set: molecular weight=382.628 }} |
+ | {{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}} | ||
+ | {{#set: consumed by=RXN66-27}} | ||
+ | {{#set: produced by=RXN66-26}} |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-8646
- smiles:
- CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
- common name:
- 7-dehydrodesmosterol
- inchi key:
- InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
- molecular weight:
- 382.628
- Synonym(s):
- 5α-cholesta-5,7,24-trien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.