Difference between revisions of "Tiso gene 17306"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_17306 == * Synonym(s): == Reactions associated == * Reaction: MYO-INOSITOL-2-DEHYDROGENASE-RXN ** Source: orthology-esiliculosus =...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17306 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] | |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | == Pathways associated == |
+ | * [[P562-PWY]] | ||
+ | * [[PWY-7241]] | ||
+ | * [[PWY-7237]] | ||
+ | * [[PWY-5940]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}} | |
− | + | {{#set: pathway associated=P562-PWY|PWY-7241|PWY-7237|PWY-5940}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:18, 21 March 2018
Gene Tiso_gene_17306
- Synonym(s):
Reactions associated
- Reaction: MYO-INOSITOL-2-DEHYDROGENASE-RXN
- Source: orthology-esiliculosus