Difference between revisions of "NUCLEOSIDE-DIP-KIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NUCLEOSIDE-DIP-KIN-RXN NUCLEOSIDE-DIP-KIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NUCLEOSIDE-DIP-KIN-RXN NUCLEOSIDE-DIP-KIN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | ** adenylate_kinase_domain-containing_protein_1 |
− | ** | + | ** nucleoside_diphosphate_kinase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.7.4.6 EC-2.7.4.6] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[ATP]][c] '''+''' 1 [[Nucleoside-Diphosphates]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[Nucleoside-Triphosphates]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 a nucleoside diphosphate[c] '''=>''' 1 ADP[c] '''+''' 1 a nucleoside triphosphate[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16529]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_17271]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_9290]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_195]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17272]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18224]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18113 18113] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00331 R00331] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P15531 P15531] |
− | * | + | ** [http://www.uniprot.org/uniprot/P15266 P15266] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P19804 P19804] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q05982 Q05982] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P15532 P15532] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P22887 P22887] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P22392 P22392] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P65533 P65533] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O84508 O84508] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P84284 P84284] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43802 P43802] |
+ | ** [http://www.uniprot.org/uniprot/O26358 O26358] | ||
+ | ** [http://www.uniprot.org/uniprot/P56075 P56075] | ||
+ | ** [http://www.uniprot.org/uniprot/O67528 O67528] | ||
+ | ** [http://www.uniprot.org/uniprot/O83974 O83974] | ||
+ | ** [http://www.uniprot.org/uniprot/O29491 O29491] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZE91 Q9ZE91] | ||
+ | ** [http://www.uniprot.org/uniprot/Q58661 Q58661] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PIG7 Q9PIG7] | ||
+ | ** [http://www.uniprot.org/uniprot/Q13232 Q13232] | ||
+ | ** [http://www.uniprot.org/uniprot/P48817 P48817] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A763 P0A763] | ||
+ | ** [http://www.uniprot.org/uniprot/P08879 P08879] | ||
+ | ** [http://www.uniprot.org/uniprot/Q02254 Q02254] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01402 Q01402] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01768 Q01768] | ||
+ | ** [http://www.uniprot.org/uniprot/P47922 P47922] | ||
+ | ** [http://www.uniprot.org/uniprot/P36010 P36010] | ||
+ | ** [http://www.uniprot.org/uniprot/Q07661 Q07661] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S8M2 Q9S8M2] | ||
+ | ** [http://www.uniprot.org/uniprot/P47921 P47921] | ||
+ | ** [http://www.uniprot.org/uniprot/P47923 P47923] | ||
+ | ** [http://www.uniprot.org/uniprot/P81766 P81766] | ||
+ | ** [http://www.uniprot.org/uniprot/P50589 P50589] | ||
+ | ** [http://www.uniprot.org/uniprot/P74494 P74494] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59636 Q59636] | ||
+ | ** [http://www.uniprot.org/uniprot/O49203 O49203] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39839 Q39839] | ||
+ | ** [http://www.uniprot.org/uniprot/Q96559 Q96559] | ||
+ | ** [http://www.uniprot.org/uniprot/P39207 P39207] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZGE0 Q9ZGE0] | ||
+ | ** [http://www.uniprot.org/uniprot/P49740 P49740] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9UUY8 Q9UUY8] | ||
+ | ** [http://www.uniprot.org/uniprot/O64903 O64903] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=ORF}} | ||
+ | {{#set: common name=adenylate_kinase_domain-containing_protein_1}} | ||
+ | {{#set: common name=nucleoside_diphosphate_kinase}} | ||
+ | {{#set: ec number=EC-2.7.4.6}} | ||
+ | {{#set: gene associated=Tiso_gene_16529|Tiso_gene_17271|Tiso_gene_9290|Tiso_gene_195|Tiso_gene_17272|Tiso_gene_18224}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:19, 21 March 2018
Contents
Reaction NUCLEOSIDE-DIP-KIN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- adenylate_kinase_domain-containing_protein_1
- nucleoside_diphosphate_kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 Nucleoside-Diphosphates[c] => 1 ADP[c] + 1 Nucleoside-Triphosphates[c]
- With common name(s):
- 1 ATP[c] + 1 a nucleoside diphosphate[c] => 1 ADP[c] + 1 a nucleoside triphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16529
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17271
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9290
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_195
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17272
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18224
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT:
- P15531
- P15266
- P19804
- Q05982
- P15532
- P22887
- P22392
- P65533
- O84508
- P84284
- P43802
- O26358
- P56075
- O67528
- O83974
- O29491
- Q9ZE91
- Q58661
- Q9PIG7
- Q13232
- P48817
- P0A763
- P08879
- Q02254
- Q01402
- Q01768
- P47922
- P36010
- Q07661
- Q9S8M2
- P47921
- P47923
- P81766
- P50589
- P74494
- Q59636
- O49203
- Q39839
- Q96559
- P39207
- Q9ZGE0
- P49740
- Q9UUY8
- O64903