Difference between revisions of "N-acyl-sphingosylphosphorylcholine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-acyl-sphingosylphosphorylcholine N-acyl-sphingosylphosphorylcholine] == * common name: ** an...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-acyl-sphingosylphosphorylcholine N-acyl-sphingosylphosphorylcholine] ==
−
* smiles:
+
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)
+
−
* inchi key:
+
−
** InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N
+
 
* common name:
 
* common name:
−
** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
+
** an N-acyl-sphingosylphosphorylcholine
−
* molecular weight:
+
−
** 683.068   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14177]]
+
* [[RXN-12339]]
 +
* [[RXN-15212]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15211]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=an N-acyl-sphingosylphosphorylcholine}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05813 C05813]
+
{{#set: consumed by=RXN-12339|RXN-15212}}
−
* CHEBI:
+
{{#set: produced by=RXN-15211}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28423 28423]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280835 5280835]
+
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)}}
+
−
{{#set: inchi key=InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N}}
+
−
{{#set: common name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
+
−
{{#set: molecular weight=683.068    }}
+
−
{{#set: consumed by=RXN-14177}}
+

Latest revision as of 19:21, 21 March 2018

Metabolite N-acyl-sphingosylphosphorylcholine

  • common name:
    • an N-acyl-sphingosylphosphorylcholine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-acyl-sphingosylphosphorylcholine&oldid=41133"