Difference between revisions of "CPDQT-28"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-661 PWY0-661] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == * smiles: ** CSCCCCCC(=O)C([O-])=O * common name: ** 7-(methylthio)-2-oxo...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CSCCCCCC(=O)C([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** 7-(methylthio)-2-oxoheptanoate |
| + | * inchi key: | ||
| + | ** InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 189.249 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 7-(methylthio)-2-oxoheptanoic acid |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXNQT-4168]] | |
| − | + | * [[RXN-18207]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237184 44237184] |
| − | {{#set: | + | * KNAPSACK : C00007645 |
| − | {{#set: common name= | + | {{#set: smiles=CSCCCCCC(=O)C([O-])=O}} |
| − | {{#set: | + | {{#set: common name=7-(methylthio)-2-oxoheptanoate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=189.249 }} |
| − | {{#set: | + | {{#set: common name=7-(methylthio)-2-oxoheptanoic acid}} |
| + | {{#set: produced by=RXNQT-4168|RXN-18207}} | ||
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CPDQT-28
- smiles:
- CSCCCCCC(=O)C([O-])=O
- common name:
- 7-(methylthio)-2-oxoheptanoate
- inchi key:
- InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
- molecular weight:
- 189.249
- Synonym(s):
- 7-(methylthio)-2-oxoheptanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007645
"CSCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.
