Difference between revisions of "Tiso gene 15852"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == * smiles: ** CSCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=TWAIOPPFLZEXC...")
(Created page with "Category:Gene == Gene Tiso_gene_15852 == * right end position: ** 2068 * transcription direction: ** POSITIVE * left end position: ** 37 * centisome position: ** 0.7784557...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] ==
+
== Gene Tiso_gene_15852 ==
* smiles:
+
* right end position:
** CSCCCCCC(=O)C([O-])=O
+
** 2068
* inchi key:
+
* transcription direction:
** InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
+
** POSITIVE
* common name:
+
* left end position:
** 7-(methylthio)-2-oxoheptanoate
+
** 37
* molecular weight:
+
* centisome position:
** 189.249    
+
** 0.77845573    
 
* Synonym(s):
 
* Synonym(s):
** 7-(methylthio)-2-oxoheptanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DIMETHUROPORDEHYDROG-RXN]]
* [[RXNQT-4168]]
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-18207]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7377]]
 +
* [[PWY-5194]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=2068}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237184 44237184]
+
{{#set: transcription direction=POSITIVE}}
* KNAPSACK : C00007645
+
{{#set: left end position=37}}
{{#set: smiles=CSCCCCCC(=O)C([O-])=O}}
+
{{#set: centisome position=0.77845573   }}
{{#set: inchi key=InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M}}
+
{{#set: reaction associated=DIMETHUROPORDEHYDROG-RXN}}
{{#set: common name=7-(methylthio)-2-oxoheptanoate}}
+
{{#set: pathway associated=PWY-7377|PWY-5194}}
{{#set: molecular weight=189.249   }}
+
{{#set: common name=7-(methylthio)-2-oxoheptanoic acid}}
+
{{#set: produced by=RXNQT-4168|RXN-18207}}
+

Latest revision as of 19:23, 21 March 2018

Gene Tiso_gene_15852

  • right end position:
    • 2068
  • transcription direction:
    • POSITIVE
  • left end position:
    • 37
  • centisome position:
    • 0.77845573
  • Synonym(s):

Reactions associated

Pathways associated

External links