Difference between revisions of "Aliphatic-Amines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aliphatic-Amines Aliphatic-Amines] == * common name: ** an aliphatic amine * Synonym(s): ** RCH...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aliphatic-Amines Aliphatic-Amines] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an aliphatic amine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** RCH2NH2 | ||
| + | ** RCH(2)NH(2) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[AMINEOXID-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an aliphatic amine}} | |
| − | + | {{#set: common name=RCH2NH2|RCH(2)NH(2)}} | |
| − | + | {{#set: consumed by=AMINEOXID-RXN}} | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite Aliphatic-Amines
- common name:
- an aliphatic amine
- Synonym(s):
- RCH2NH2
- RCH(2)NH(2)
