Difference between revisions of "Tiso gene 6071"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] == * smiles: ** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=...")
(Created page with "Category:Gene == Gene Tiso_gene_6071 == * Synonym(s): == Reactions associated == * Reaction: 2.7.10.1-RXN ** Source: orthology-esiliculosus * Reaction: 3.6.4.4-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] ==
+
== Gene Tiso_gene_6071 ==
* smiles:
+
** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
+
* inchi key:
+
** InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
+
* common name:
+
** trans-3-hydroxycotinine-glucuronide
+
* molecular weight:
+
** 367.335   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.7.10.1-RXN]]
* [[RXN66-162]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[3.6.4.4-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[PROTEIN-KINASE-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=2.7.10.1-RXN|3.6.4.4-RXN|PROTEIN-KINASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820156 91820156]
+
* HMDB : HMDB01204
+
{{#set: smiles=C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))}}
+
{{#set: inchi key=InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M}}
+
{{#set: common name=trans-3-hydroxycotinine-glucuronide}}
+
{{#set: molecular weight=367.335    }}
+
{{#set: produced by=RXN66-162}}
+

Latest revision as of 19:25, 21 March 2018

Gene Tiso_gene_6071

  • Synonym(s):

Reactions associated

Pathways associated

External links