Difference between revisions of "Tiso gene 7035"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
(Created page with "Category:Gene == Gene Tiso_gene_7035 == * right end position: ** 11195 * transcription direction: ** POSITIVE * left end position: ** 10183 * centisome position: ** 87.928...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] ==
+
== Gene Tiso_gene_7035 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 11195
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VVLBCJHQULSXJN-QWOXCLFSSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-oxo-icosatetraenoyl-CoA
+
** 10183
−
* molecular weight:
+
* centisome position:
−
** 1063.942    
+
** 87.928505    
 
* Synonym(s):
 
* Synonym(s):
−
** (8Z,11Z,14Z,17Z)-3-oxo-icosa-8,11,14,17-tetraenoyl-CoA
 
−
** 3-oxo-eicosatetraenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16020]]
+
* Reaction: [[3.1.3.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=11195}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698357 70698357]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=10183}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71491 71491]
+
{{#set: centisome position=87.928505   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
{{#set: inchi key=InChIKey=VVLBCJHQULSXJN-QWOXCLFSSA-J}}
+
−
{{#set: common name=3-oxo-icosatetraenoyl-CoA}}
+
−
{{#set: molecular weight=1063.942   }}
+
−
{{#set: common name=(8Z,11Z,14Z,17Z)-3-oxo-icosa-8,11,14,17-tetraenoyl-CoA|3-oxo-eicosatetraenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16020}}
+

Latest revision as of 19:27, 21 March 2018

Gene Tiso_gene_7035

  • right end position:
    • 11195
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10183
  • centisome position:
    • 87.928505
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7035&oldid=41654"