Difference between revisions of "PWY-7494"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * smiles: ** C(C1(C=CC(=CC=1)O))(=O)[O-] * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7494 PWY-7494] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7494 PWY-7494] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** choline degradation IV |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''4''' reactions in the full pathway |
| − | * [[ | + | * [[BADH-RXN]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | + | *** [[Tiso_gene_3513]] | |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-6268]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PWY-3721 PWY-3721] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PWY-3721 PWY-3721] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=choline degradation IV}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:29, 21 March 2018
Pathway PWY-7494
- taxonomic range:
- common name:
- choline degradation IV
- Synonym(s):
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- BADH-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-6268
- 0 associated gene:
- 1 reconstruction source(s) associated:
