Difference between revisions of "CPD-7006"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptide-C-terminal-Glycines Peptide-C-terminal-Glycines] == * common name: ** a [protein] C-ter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == |
| + | * smiles: | ||
| + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
* common name: | * common name: | ||
| − | ** a | + | ** tetrahydrogeranylgeranyl chlorophyll a |
| + | * inchi key: | ||
| + | ** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M | ||
| + | * molecular weight: | ||
| + | ** 890.479 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** a | + | ** tetrahydroGG-chlorophyll a |
| + | ** tetrahydroGG-chl a | ||
| + | ** tetrahydrogeranylgeranyl-chl a | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7666]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7665]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name=a | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313] |
| − | {{#set: consumed by= | + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} |
| + | {{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}} | ||
| + | {{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}} | ||
| + | {{#set: molecular weight=890.479 }} | ||
| + | {{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}} | ||
| + | {{#set: consumed by=RXN-7666}} | ||
| + | {{#set: produced by=RXN-7665}} | ||
Latest revision as of 19:29, 21 March 2018
Contents
Metabolite CPD-7006
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- tetrahydrogeranylgeranyl chlorophyll a
- inchi key:
- InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
- molecular weight:
- 890.479
- Synonym(s):
- tetrahydroGG-chlorophyll a
- tetrahydroGG-chl a
- tetrahydrogeranylgeranyl-chl a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
