Difference between revisions of "CPD0-882"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-4-5-TRISPHOSPHATE INOSITOL-1-4-5-TRISPHOSPHATE] == * smiles: ** C1(O)(C(OP([O-])([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-882 CPD0-882] == * smiles: ** CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2)) * common name:...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-882 CPD0-882] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 1,6-anhydro-N-acetyl-β-muramate |
| + | * inchi key: | ||
| + | ** InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 274.25 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1,6-anhMurNAc |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5226]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658592 90658592] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.4883322.html 4883322] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58690 58690] |
| − | * | + | * BIGG : anhm |
| − | {{#set: smiles= | + | {{#set: smiles=CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))}} |
| − | {{#set: | + | {{#set: common name=1,6-anhydro-N-acetyl-β-muramate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=274.25 }} |
| − | {{#set: common name= | + | {{#set: common name=1,6-anhMurNAc}} |
| − | + | {{#set: produced by=RXN0-5226}} | |
| − | {{#set: produced by= | + | |
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD0-882
- smiles:
- CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))
- common name:
- 1,6-anhydro-N-acetyl-β-muramate
- inchi key:
- InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M
- molecular weight:
- 274.25
- Synonym(s):
- 1,6-anhMurNAc
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))" cannot be used as a page name in this wiki.
