Difference between revisions of "Tiso gene 287"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Gene == Gene Tiso_gene_287 == * right end position: ** 32742 * transcription direction: ** POSITIVE * left end position: ** 30517 * centisome position: ** 83.6196...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_287 == |
− | * | + | * right end position: |
− | ** | + | ** 32742 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 30517 |
− | * | + | * centisome position: |
− | ** | + | ** 83.619675 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-2584]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=32742}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=30517}} | |
− | + | {{#set: centisome position=83.619675 }} | |
− | + | {{#set: reaction associated=RXN0-2584}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:30, 21 March 2018
Gene Tiso_gene_287
- right end position:
- 32742
- transcription direction:
- POSITIVE
- left end position:
- 30517
- centisome position:
- 83.619675
- Synonym(s):
Reactions associated
- Reaction: RXN0-2584
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation