Difference between revisions of "RXN-16067"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * inchi key: ** InChIKey=AHL...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16067 RXN-16067] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16067 RXN-16067] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 1-acylglycerol-3-phosphate_o-acyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[CPD0-2113]][c] '''+''' 1 [[Long-Chain-Acyl-ACPs]][c] '''=>''' 1 [[1-Stearoyl-L-Phosphatidate]][c] '''+''' 1 [[ACP]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 1-stearoyl-sn-glycerol 3-phosphate[c] '''+''' 1 a long-chain acyl-[acyl-carrier protein][c] '''=>''' 1 a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate[c] '''+''' 1 a holo-[acyl-carrier protein][c] | |
− | + | ||
− | * [ | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | == | + | * Gene: [[Tiso_gene_13959]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[PWY-7587]], oleate biosynthesis III (cyanobacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7587 PWY-7587] |
− | * [[ | + | ** '''1''' reactions found over '''3''' reactions in the full pathway |
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}} | |
− | + | {{#set: ec number=EC-2.3.1.51}} | |
− | + | {{#set: gene associated=Tiso_gene_13959}} | |
− | + | {{#set: in pathway=PWY-7587}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:30, 21 March 2018
Contents
Reaction RXN-16067
- direction:
- LEFT-TO-RIGHT
- common name:
- 1-acylglycerol-3-phosphate_o-acyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD0-2113[c] + 1 Long-Chain-Acyl-ACPs[c] => 1 1-Stearoyl-L-Phosphatidate[c] + 1 ACP[c]
- With common name(s):
- 1 1-stearoyl-sn-glycerol 3-phosphate[c] + 1 a long-chain acyl-[acyl-carrier protein][c] => 1 a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate[c] + 1 a holo-[acyl-carrier protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13959
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7587, oleate biosynthesis III (cyanobacteria): PWY-7587
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation