Difference between revisions of "RXN-2962"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2962 RXN-2962] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2962 RXN-2962] ==
−
* smiles:
+
* direction:
−
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
+
** [http://enzyme.expasy.org/EC/1.1.1.284 EC-1.1.1.284]
−
* common name:
+
−
** aldehydo-D-glucose
+
−
* molecular weight:
+
−
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
 
−
** linear D-glucose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14408]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[S-HYDROXYMETHYLGLUTATHIONE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[CPD-548]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 S-(hydroxymethyl)glutathione[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 S-formylglutathione[c] '''+''' 1 H+[c] '''+''' 1 NAD(P)H[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18459]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-1801]], formaldehyde oxidation II (glutathione-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1801 PWY-1801]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107526 107526]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06983 R06983]
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07140 R07140]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42758 42758]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
{{#set: ec number=EC-1.1.1.284}}
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N}}
+
{{#set: gene associated=Tiso_gene_18459}}
−
{{#set: common name=aldehydo-D-glucose}}
+
{{#set: in pathway=PWY-1801}}
−
{{#set: molecular weight=180.157    }}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal|linear D-glucose}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: consumed by=RXN-14408}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:35, 21 March 2018

Reaction RXN-2962

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-1801, formaldehyde oxidation II (glutathione-dependent): PWY-1801
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-2962&oldid=42541"