Difference between revisions of "CPD-17420"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_2241 == * Synonym(s): == Reactions associated == * 2.7.8.23-RXN ** pantograph-esiliculosus * RXN-10827 ** pantograph-[...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_2241 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17420 CPD-17420] ==
 +
* smiles:
 +
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* common name:
 +
** 6-hydroxytyphasterol
 +
* inchi key:
 +
** InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
 +
* molecular weight:
 +
** 450.701   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.7.8.23-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-4241]]
* [[RXN-10827]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-10828]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
* [[PWY-6322]]
+
* [[PWY-7769]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=2.7.8.23-RXN|RXN-10827|RXN-10828}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6322|PWY-7769}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515372 102515372]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=6-hydroxytyphasterol}}
 +
{{#set: inchi key=InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N}}
 +
{{#set: molecular weight=450.701    }}
 +
{{#set: produced by=RXN-4241}}

Latest revision as of 19:36, 21 March 2018

Metabolite CPD-17420

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6-hydroxytyphasterol
  • inchi key:
    • InChIKey=QQPPQQNYVDYNAA-VKTWQGKFSA-N
  • molecular weight:
    • 450.701
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.