Difference between revisions of "RXN-14223"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJR...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14223 RXN-14223] == * direction: ** REVERSIBLE * common name: ** ORF ** at1g17160 ** ribokinase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14223 RXN-14223] ==
−
* smiles:
+
* direction:
−
** C(CCC(C(=O)[O-])[N+])([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
+
 
* common name:
 
* common name:
−
** D-glutamate
+
** ORF
−
* molecular weight:
+
** at1g17160
−
** 146.122   
+
** ribokinase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.7.1.15 EC-2.7.1.15]
 
* Synonym(s):
 
* Synonym(s):
−
** D-glutamic acid
 
−
** D-glu
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[ATP]][c] '''+''' 1 [[2-DEOXYRIBOSE]][c] '''<=>''' 1 [[DEOXY-RIBOSE-5P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
−
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 2'-deoxyribose[c] '''<=>''' 1 2-deoxy-D-ribose 5-phosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_911]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17974]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_81]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18204]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_82]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7682]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6893-26-1
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30874 30874]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297]
+
* LIGAND-RXN:
−
* HMDB : HMDB03339
+
** [http://www.genome.jp/dbget-bin/www_bget?R02750 R02750]
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00217 C00217]
+
{{#set: common name=ORF}}
−
* CHEBI:
+
{{#set: common name=at1g17160}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986]
+
{{#set: common name=ribokinase}}
−
* BIGG : glu__D
+
{{#set: ec number=EC-2.7.1.15}}
−
{{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}}
+
{{#set: gene associated=Tiso_gene_911|Tiso_gene_17974|Tiso_gene_81|Tiso_gene_18204|Tiso_gene_82|Tiso_gene_7682}}
−
{{#set: inchi key=InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M}}
+
{{#set: in pathway=}}
−
{{#set: common name=D-glutamate}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=146.122    }}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: common name=D-glutamic acid|D-glu}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: reversible reaction associated=D-ALANINE-AMINOTRANSFERASE-RXN}}
+

Latest revision as of 19:39, 21 March 2018

Reaction RXN-14223

  • direction:
    • REVERSIBLE
  • common name:
    • ORF
    • at1g17160
    • ribokinase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 2'-deoxyribose[c] <=> 1 2-deoxy-D-ribose 5-phosphate[c] + 1 H+[c] + 1 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14223&oldid=42966"