Difference between revisions of "DATP"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-467 PWY1F-467] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** dATP |
+ | * inchi key: | ||
+ | ** InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J | ||
+ | * molecular weight: | ||
+ | ** 487.152 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2'-deoxyATP | ||
+ | ** 2'-deoxyadenosine triphosphate | ||
+ | ** deoxy-ATP | ||
+ | ** deoxyadenosine-triphosphate | ||
+ | ** 2'-deoxyadenosine-5'-triphosphate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14195]] | |
− | * [[ | + | * [[RXN0-384]] |
− | ** | + | * [[RME255]] |
− | + | * [[DATUP]] | |
− | + | * [[DATCY]] | |
− | * | + | * [[RXN-14290]] |
− | *** [[ | + | * [[RXN-14214]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [ | + | * [[DADPKIN-RXN]] |
+ | * [[NDPKm]] | ||
+ | * [[NDPK]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14192]] | ||
== External links == | == External links == | ||
− | * | + | * CAS : 1927-31-7 |
− | ** [http:// | + | * BIGG : datp |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25320183 25320183] |
− | {{#set: | + | * HMDB : HMDB01532 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00131 C00131] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61404 61404] | ||
+ | * METABOLIGHTS : MTBLC61404 | ||
+ | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}} | ||
+ | {{#set: common name=dATP}} | ||
+ | {{#set: inchi key=InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J}} | ||
+ | {{#set: molecular weight=487.152 }} | ||
+ | {{#set: common name=2'-deoxyATP|2'-deoxyadenosine triphosphate|deoxy-ATP|deoxyadenosine-triphosphate|2'-deoxyadenosine-5'-triphosphate}} | ||
+ | {{#set: consumed by=RXN-14195|RXN0-384|RME255|DATUP|DATCY|RXN-14290|RXN-14214}} | ||
+ | {{#set: produced by=DADPKIN-RXN|NDPKm|NDPK}} | ||
+ | {{#set: reversible reaction associated=RXN-14192}} |
Latest revision as of 19:39, 21 March 2018
Contents
Metabolite DATP
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
- common name:
- dATP
- inchi key:
- InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J
- molecular weight:
- 487.152
- Synonym(s):
- 2'-deoxyATP
- 2'-deoxyadenosine triphosphate
- deoxy-ATP
- deoxyadenosine-triphosphate
- 2'-deoxyadenosine-5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1927-31-7
- BIGG : datp
- PUBCHEM:
- HMDB : HMDB01532
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61404
"C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.