Difference between revisions of "PWY66-423"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] == * smiles: ** C1(=CC(C(C=C1)O)O) * inchi key: ** InChIKey=YDRSQRPHLBEPTP-PHD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-423 PWY66-423] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-423 PWY66-423] ==
* smiles:
+
* taxonomic range:
** C1(=CC(C(C=C1)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N
+
 
* common name:
 
* common name:
** (1R,2R)-cyclohexa-3,5-diene-1,2-diol
+
** fructose 2,6-bisphosphate biosynthesis
* molecular weight:
+
** 112.128   
+
 
* Synonym(s):
 
* Synonym(s):
** trans-1,2-dihydrobenzene-1,2-diol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.46-RXN]]
* [[1.3.1.20-RXN]]
+
** 4 associated gene(s):
 +
*** [[Tiso_gene_15398]]
 +
*** [[Tiso_gene_892]]
 +
*** [[Tiso_gene_893]]
 +
*** [[Tiso_gene_2100]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_15398]]
 +
*** [[Tiso_gene_804]]
 +
*** [[Tiso_gene_2100]]
 +
*** [[Tiso_gene_893]]
 +
*** [[Tiso_gene_892]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=149186 149186]
+
{{#set: common name=fructose 2,6-bisphosphate biosynthesis}}
* CHEMSPIDER:
+
{{#set: reaction found=2}}
** [http://www.chemspider.com/Chemical-Structure.131491.html 131491]
+
{{#set: total reaction=2}}
* CHEBI:
+
{{#set: completion rate=100.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10702 10702]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04221 C04221]
+
* HMDB : HMDB01164
+
{{#set: smiles=C1(=CC(C(C=C1)O)O)}}
+
{{#set: inchi key=InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N}}
+
{{#set: common name=(1R,2R)-cyclohexa-3,5-diene-1,2-diol}}
+
{{#set: molecular weight=112.128    }}
+
{{#set: common name=trans-1,2-dihydrobenzene-1,2-diol}}
+
{{#set: reversible reaction associated=1.3.1.20-RXN}}
+

Latest revision as of 19:47, 21 March 2018

Pathway PWY66-423

  • taxonomic range:
  • common name:
    • fructose 2,6-bisphosphate biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links