Difference between revisions of "PWY-7347"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=YB...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7347 PWY-7347] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-32011 TAX-3...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7347 PWY-7347] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-32011 TAX-32011] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40222 TAX-40222] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-429 TAX-429] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-39773 TAX-39773] | ||
* common name: | * common name: | ||
| − | ** | + | ** sucrose biosynthesis III |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[PGLUCISOM-RXN]] | |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| − | * [ | + | *** [[Tiso_gene_19480]] |
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[SUCROSE-PHOSPHATE-SYNTHASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_14247]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-PHOSPHATASE-RXN SUCROSE-PHOSPHATASE-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-32011}} | |
| − | + | {{#set: taxonomic range=TAX-40222}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-429}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-39773}} |
| − | {{#set: | + | {{#set: common name=sucrose biosynthesis III}} |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | {{#set: common name= | + | {{#set: total reaction=3}} |
| − | {{#set: | + | {{#set: completion rate=67.0}} |
| − | {{#set: | + | |
Latest revision as of 19:47, 21 March 2018
Pathway PWY-7347
- taxonomic range:
- common name:
- sucrose biosynthesis III
- Synonym(s):
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- PGLUCISOM-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- SUCROSE-PHOSPHATE-SYNTHASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
