Difference between revisions of "CPD-237"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] == * smiles: ** C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2)) * common name: ** indole-3-ac...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** indole-3-acetamide |
+ | * inchi key: | ||
+ | ** InChIKey=ZOAMBXDOGPRZLP-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 174.202 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1H-indole-3-acetamide |
+ | ** indoleacetamide | ||
+ | ** (indol-3-yl)acetamide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXNN-404]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-7567]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 879-37-8 | ||
+ | * DRUGBANK : DB08652 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=397 397] |
+ | * HMDB : HMDB29739 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02693 C02693] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.386.html 386] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16031 16031] |
− | {{#set: smiles= | + | * METABOLIGHTS : MTBLC16031 |
− | {{#set: | + | {{#set: smiles=C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2))}} |
− | {{#set: | + | {{#set: common name=indole-3-acetamide}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=ZOAMBXDOGPRZLP-UHFFFAOYSA-N}} |
− | {{#set: common name=( | + | {{#set: molecular weight=174.202 }} |
− | {{#set: produced by=RXN- | + | {{#set: common name=1H-indole-3-acetamide|indoleacetamide|(indol-3-yl)acetamide}} |
+ | {{#set: consumed by=RXNN-404}} | ||
+ | {{#set: produced by=RXN-7567}} |
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite CPD-237
- smiles:
- C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2))
- common name:
- indole-3-acetamide
- inchi key:
- InChIKey=ZOAMBXDOGPRZLP-UHFFFAOYSA-N
- molecular weight:
- 174.202
- Synonym(s):
- 1H-indole-3-acetamide
- indoleacetamide
- (indol-3-yl)acetamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 879-37-8
- DRUGBANK : DB08652
- PUBCHEM:
- HMDB : HMDB29739
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16031