Difference between revisions of "Tiso gene 17383"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8892 CPD-8892] == * smiles: ** CCCCCC=CCC=CC=CC=C[CH]1(O[CH]1CCCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_17383 == * right end position: ** 3680 * transcription direction: ** NEGATIVE * left end position: ** 110 * centisome position: ** 2.950643...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17383 == |
− | * | + | * right end position: |
− | ** | + | ** 3680 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 110 |
− | * | + | * centisome position: |
− | ** | + | ** 2.9506438 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPSYN-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3680}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=110}} | |
− | + | {{#set: centisome position=2.9506438 }} | |
− | + | {{#set: reaction associated=ATPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:52, 21 March 2018
Gene Tiso_gene_17383
- right end position:
- 3680
- transcription direction:
- NEGATIVE
- left end position:
- 110
- centisome position:
- 2.9506438
- Synonym(s):
Reactions associated
- Reaction: ATPSYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation