Difference between revisions of "RXN-12362"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17382 CPD-17382] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12362 RXN-12362] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17382 CPD-17382] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12362 RXN-12362] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DRQAURCKCKDINZ-KPYXOPPTSA-J
+
 
* common name:
 
* common name:
−
** (3R)-hydroxy-tetracosapentaenoyl-CoA
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 1120.05   
+
** [http://enzyme.expasy.org/EC/2.3.1.84 EC-2.3.1.84]
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA
 
−
** (3R)-hydroxy-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA
 
−
** (3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16130]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[BUTANOL]][c] '''=>''' 1 [[CPD-13346]][c] '''+''' 1 [[CO-A]][c]
−
* [[RXN-16129]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 acetyl-CoA[c] '''+''' 1 butan-1-ol[c] '''=>''' 1 butyl acetate[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10528]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6801]], volatile esters biosynthesis (during fruit ripening): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6801 PWY-6801]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551545 72551545]
+
{{#set: common name=ORF}}
−
* CHEBI:
+
{{#set: ec number=EC-2.3.1.84}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76462 76462]
+
{{#set: gene associated=Tiso_gene_10528}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: in pathway=PWY-6801}}
−
{{#set: inchi key=InChIKey=DRQAURCKCKDINZ-KPYXOPPTSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=(3R)-hydroxy-tetracosapentaenoyl-CoA}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: molecular weight=1120.05    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=(3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA|(3R)-hydroxy-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA|(3R)-hydroxy-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16130}}
+
−
{{#set: produced by=RXN-16129}}
+

Latest revision as of 19:56, 21 March 2018

Reaction RXN-12362

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 acetyl-CoA[c] + 1 butan-1-ol[c] => 1 butyl acetate[c] + 1 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6801, volatile esters biosynthesis (during fruit ripening): PWY-6801
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12362&oldid=44714"