Difference between revisions of "RXN-14388"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388] ==
* smiles:
+
* direction:
** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
+
* common name:
+
** linoleoyl-CoA
+
* molecular weight:
+
** 1025.937   
+
 
* Synonym(s):
 
* Synonym(s):
** cis,cis-octadeca-9,12-dienoyl-CoA
 
** (9Z,12Z)-octadeca-9,12-dienoyl-CoA
 
** 18:2(n-6)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[1.14.19.3-RXN]]
+
* With identifiers:
* [[RXN-16094]]
+
** 1 [[CD-SP-2Fe2S-Complex]][c] '''+''' 1 [[FeS-Cluster-Co-Chaperones]][c] '''=>''' 1 [[L-Cysteine-Desulfurases]][c] '''+''' 1 [[Co-chaperone-SP-2Fe2S-Complex]][c]
* [[LINOLEOYL-RXN]]
+
* With common name(s):
== Reaction(s) known to produce the compound ==
+
** 1 a [cysteine desulfurase]-[scaffold protein-(2Fe-2S)] complex[c] '''+''' 1 an [Fe-S cluster biosynthesis co-chaperone][c] '''=>''' 1 an [L-cysteine desulfurase][c] '''+''' 1 a [co-chaperone]-[scaffold protein-(2Fe-2S)] complex[c]
* [[LNLCCOAL]]
+
 
* [[RXN-9673]]
+
== Genes associated with this reaction  ==
== Reaction(s) of unknown directionality ==
+
== Pathways  ==
 +
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
 +
** '''10''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245440 25245440]
+
{{#set: in pathway=PWY-7250}}
* CHEBI:
+
{{#set: reconstruction category=annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57383 57383]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.genome.jp/dbget-bin/www_bget?C02050 C02050]
+
* HMDB : HMDB01064
+
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J}}
+
{{#set: common name=linoleoyl-CoA}}
+
{{#set: molecular weight=1025.937    }}
+
{{#set: common name=cis,cis-octadeca-9,12-dienoyl-CoA|(9Z,12Z)-octadeca-9,12-dienoyl-CoA|18:2(n-6)}}
+
{{#set: consumed by=1.14.19.3-RXN|RXN-16094|LINOLEOYL-RXN}}
+
{{#set: produced by=LNLCCOAL|RXN-9673}}
+

Latest revision as of 19:56, 21 March 2018

Reaction RXN-14388

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7250, [2Fe-2S] iron-sulfur cluster biosynthesis: PWY-7250
    • 10 reactions found over 10 reactions in the full pathway

Reconstruction information

External links