Difference between revisions of "RXN-22"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-22 RXN-22] == * direction: ** LEFT-TO-RIGHT * common name: ** argininosuccinate_lyase * ec numb...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-22 RXN-22] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HDTRYLNUVZCQOY-LIZSDCNHSA-N
+
 
* common name:
 
* common name:
−
** α,α-trehalose
+
** argininosuccinate_lyase
−
* molecular weight:
+
* ec number:
−
** 342.299   
+
** [http://enzyme.expasy.org/EC/4.3.2.1 EC-4.3.2.1]
 
* Synonym(s):
 
* Synonym(s):
−
** α-D-glucopyranosyl α-D-glucopyranoside
 
−
** α-D-Glcp-(1↔1)-α-D-Glcp
 
−
** D-(+)-trehalose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[TREHALA-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CANAVANINOSUCCINATE]][c] '''=>''' 1 [[CANAVANINE]][c] '''+''' 1 [[FUM]][c]
−
* [[TREHALOSEPHOSPHA-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 canavaninosuccinate[c] '''=>''' 1 L-canavanine[c] '''+''' 1 fumarate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2485]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5]], canavanine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5 PWY-5]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 99-20-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC16551
+
{{#set: common name=argininosuccinate_lyase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-4.3.2.1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7427 7427]
+
{{#set: gene associated=Tiso_gene_2485}}
−
* KEGG-GLYCAN : G00293
+
{{#set: in pathway=PWY-5}}
−
* HMDB : HMDB00975
+
{{#set: reconstruction category=orthology|annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01083 C01083]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.7149.html 7149]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16551 16551]
+
−
* BIGG : tre
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O}}
+
−
{{#set: inchi key=InChIKey=HDTRYLNUVZCQOY-LIZSDCNHSA-N}}
+
−
{{#set: common name=α,α-trehalose}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=α-D-glucopyranosyl α-D-glucopyranoside|α-D-Glcp-(1↔1)-α-D-Glcp|D-(+)-trehalose}}
+
−
{{#set: consumed by=TREHALA-RXN}}
+
−
{{#set: produced by=TREHALOSEPHOSPHA-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Reaction RXN-22

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • argininosuccinate_lyase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5, canavanine biosynthesis: PWY-5
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-22&oldid=45084"