Difference between revisions of "A-3-OXO-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.109-RXN 2.1.1.109-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** o-methyltransferase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] == * smiles: ** C([R])C(=O)CC(=O)[O-] * common name: ** a 3-oxo acid...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.109-RXN 2.1.1.109-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([R])C(=O)CC(=O)[O-]
 
* common name:
 
* common name:
−
** o-methyltransferase_i
+
** a 3-oxo acid
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.1.1.109 EC-2.1.1.109]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxy acid
 +
** 3-oxygen acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[6-DEMETHYLSTERIGMATOCYSTIN]][c] '''=>''' 1 [[STERIGMATOCYSTIN]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[3-OXOACID-COA-TRANSFERASE-RXN]]
−
** 1 S-adenosyl-L-methionine[c] '''+''' 1 6-demethylsterigmatocystin[c] '''=>''' 1 sterigmatocystin[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_20416]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5956]], sterigmatocystin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5956 PWY-5956]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* LIGAND-CPD:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11504 11504]
+
** [http://www.genome.jp/dbget-bin/www_bget?C01656 C01656]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03112 R03112]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47881 47881]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C([R])C(=O)CC(=O)[O-]}}
−
{{#set: common name=o-methyltransferase_i}}
+
{{#set: common name=a 3-oxo acid}}
−
{{#set: ec number=EC-2.1.1.109}}
+
{{#set: common name=3-oxy acid|3-oxygen acid}}
−
{{#set: gene associated=Tiso_gene_20416}}
+
{{#set: reversible reaction associated=3-OXOACID-COA-TRANSFERASE-RXN}}
−
{{#set: in pathway=PWY-5956}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:03, 21 March 2018

Metabolite A-3-OXO-ACID

  • smiles:
    • C([R])C(=O)CC(=O)[O-]
  • common name:
    • a 3-oxo acid
  • Synonym(s):
    • 3-oxy acid
    • 3-oxygen acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([R])C(=O)CC(=O)[O-" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=A-3-OXO-ACID&oldid=45598"