Difference between revisions of "Oxidized-flavodoxins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] == * smiles: ** C1(N=CC=NC=1C([O-])=O) * inchi key: ** InChIKe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-flavodoxins Oxidized-flavodoxins] == * common name: ** an oxidized flavodoxin * Synony...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-flavodoxins Oxidized-flavodoxins] ==
* smiles:
+
** C1(N=CC=NC=1C([O-])=O)
+
* inchi key:
+
** InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** pyrazine-2-carboxylate
+
** an oxidized flavodoxin
* molecular weight:
+
** 123.091   
+
 
* Synonym(s):
 
* Synonym(s):
** pyrazinoate
+
** a flavodoxin (oxidized)
** pyrazinoic acid
+
** pyrazinecarboxylic acid
+
** pyrazinemonocarboxylic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FLAVONADPREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYRAZIN-RXN]]
+
* [[RXN-15878]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an oxidized flavodoxin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3728869 3728869]
+
{{#set: common name=a flavodoxin (oxidized)}}
* CHEMSPIDER:
+
{{#set: consumed by=FLAVONADPREDUCT-RXN}}
** [http://www.chemspider.com/Chemical-Structure.2959374.html 2959374]
+
{{#set: produced by=RXN-15878}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71266 71266]
+
* NCI:
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=27192 27192]
+
{{#set: smiles=C1(N=CC=NC=1C([O-])=O)}}
+
{{#set: inchi key=InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M}}
+
{{#set: common name=pyrazine-2-carboxylate}}
+
{{#set: molecular weight=123.091    }}
+
{{#set: common name=pyrazinoate|pyrazinoic acid|pyrazinecarboxylic acid|pyrazinemonocarboxylic acid}}
+
{{#set: produced by=PYRAZIN-RXN}}
+

Latest revision as of 20:04, 21 March 2018

Metabolite Oxidized-flavodoxins

  • common name:
    • an oxidized flavodoxin
  • Synonym(s):
    • a flavodoxin (oxidized)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links