Difference between revisions of "CPD-14673"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-phosphatidyl-inositols L-1-phosphatidyl-inositols] == * common name: ** an L-1-phosphatidyl...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == * smiles: ** C(#N)CCC1(C=CC=CC=1) * common name: ** 3-phenylpropionitri...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == |
+ | * smiles: | ||
+ | ** C(#N)CCC1(C=CC=CC=1) | ||
* common name: | * common name: | ||
− | ** | + | ** 3-phenylpropionitrile |
+ | * inchi key: | ||
+ | ** InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 131.177 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** benzenepropanenitrile |
− | ** | + | ** 2-phenylethyl cyanide |
− | ** | + | ** 3-phenylpropanonitril |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-18229]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12581 12581] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.12061.html 12061] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85426 85426] | ||
+ | * HMDB : HMDB34236 | ||
+ | {{#set: smiles=C(#N)CCC1(C=CC=CC=1)}} | ||
+ | {{#set: common name=3-phenylpropionitrile}} | ||
+ | {{#set: inchi key=InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=131.177 }} | ||
+ | {{#set: common name=benzenepropanenitrile|2-phenylethyl cyanide|3-phenylpropanonitril}} | ||
+ | {{#set: consumed by=RXN-18229}} |
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-14673
- smiles:
- C(#N)CCC1(C=CC=CC=1)
- common name:
- 3-phenylpropionitrile
- inchi key:
- InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
- molecular weight:
- 131.177
- Synonym(s):
- benzenepropanenitrile
- 2-phenylethyl cyanide
- 3-phenylpropanonitril
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links