Difference between revisions of "RXN-16001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16001 RXN-16001] == * direction: ** LEFT-TO-RIGHT * common name: ** NADP-dependent L-serine/L-a...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16001 RXN-16001] ==
−
* smiles:
+
* direction:
−
** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
+
 
* common name:
 
* common name:
−
** 5-hydroxy-CTP
+
** NADP-dependent L-serine/L-allo-threonine dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 495.126   
+
** [http://enzyme.expasy.org/EC/1.1.1.381 EC-1.1.1.381]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxycytidine triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN0-7080]]
+
** 1 [[NADP]][c] '''+''' 1 [[L-ALLO-THREONINE]][c] '''=>''' 1 [[AMINO-ACETONE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADPH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADP+[c] '''+''' 1 L-allo-threonine[c] '''=>''' 1 aminoacetone[c] '''+''' 1 CO2[c] '''+''' 1 NADPH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16359]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584]
+
{{#set: common name=NADP-dependent L-serine/L-allo-threonine dehydrogenase}}
−
{{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
+
{{#set: ec number=EC-1.1.1.381}}
−
{{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}}
+
{{#set: gene associated=Tiso_gene_16359}}
−
{{#set: common name=5-hydroxy-CTP}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=495.126    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=5-hydroxycytidine triphosphate}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
−
{{#set: produced by=RXN0-7080}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:04, 21 March 2018

Reaction RXN-16001

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • NADP-dependent L-serine/L-allo-threonine dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16001&oldid=45712"