Difference between revisions of "RXN-7676"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1327 CPD0-1327] == * smiles: ** C1(=C(C(=O)NC(N1)=O)F) * inchi key: ** InChIKey=GHASVSINZR...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7676 RXN-7676] == * direction: ** LEFT-TO-RIGHT * common name: ** chlorophyllide-a monooxygenas...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1327 CPD0-1327] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7676 RXN-7676] ==
−
* smiles:
+
* direction:
−
** C1(=C(C(=O)NC(N1)=O)F)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 5-fluorouracil
+
** chlorophyllide-a monooxygenase
−
* molecular weight:
+
** rieske_2fe-2sdomainiss
−
** 130.078   
+
** tic55_component_of_chloroplast_import_machinery
 +
** isp_domain-containing_protein
 
* Synonym(s):
 
* Synonym(s):
 +
** chlorophyllide a oxygenase
 +
** chlorophyll-b synthase
 +
** CAO
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-7015]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
−
* [[5FLURAt]]
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 chlorophyllide a[c] '''+''' 1 oxygen[c] '''=>''' 1 71-hydroxychlorophyllide a[c] '''+''' 1 NADP+[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_152]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_8091]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4002]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13817]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12611]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5068]], chlorophyll cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB00544
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22676 22676]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3385 3385]
+
* LIGAND-RXN:
−
* HMDB : HMDB14684
+
** [http://www.genome.jp/dbget-bin/www_bget?R08203 R08203]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C07649 C07649]
+
{{#set: common name=chlorophyllide-a monooxygenase}}
−
* CHEMSPIDER:
+
{{#set: common name=rieske_2fe-2sdomainiss}}
−
** [http://www.chemspider.com/Chemical-Structure.3268.html 3268]
+
{{#set: common name=tic55_component_of_chloroplast_import_machinery}}
−
* CHEBI:
+
{{#set: common name=isp_domain-containing_protein}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=46345 46345]
+
{{#set: common name=chlorophyllide a oxygenase|chlorophyll-b synthase|CAO}}
−
{{#set: smiles=C1(=C(C(=O)NC(N1)=O)F)}}
+
{{#set: gene associated=Tiso_gene_152|Tiso_gene_8091|Tiso_gene_4002|Tiso_gene_13817|Tiso_gene_12611}}
−
{{#set: inchi key=InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N}}
+
{{#set: in pathway=PWY-5068}}
−
{{#set: common name=5-fluorouracil}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=130.078    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: reversible reaction associated=5FLURAt}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:04, 21 March 2018

Reaction RXN-7676

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chlorophyllide-a monooxygenase
    • rieske_2fe-2sdomainiss
    • tic55_component_of_chloroplast_import_machinery
    • isp_domain-containing_protein
  • Synonym(s):
    • chlorophyllide a oxygenase
    • chlorophyll-b synthase
    • CAO

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5068, chlorophyll cycle: PWY-5068
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7676&oldid=45718"