Difference between revisions of "CPD-318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05068 R05068] == * direction: ** LEFT-TO-RIGHT * common name: ** R289 * Synonym(s): == Reaction F...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * common name: ** monodehydroa...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05068 R05068] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
 
* common name:
 
* common name:
** R289
+
** monodehydroascorbate radical
 +
* inchi key:
 +
** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
 +
* molecular weight:
 +
** 175.118   
 
* Synonym(s):
 
* Synonym(s):
 +
** monodehydroascorbic acid
 +
** semidehydroascorbic acid
 +
** semidehydroascorbate
 +
** ascorbyl radical
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-3523]]
** 1.0 [[NADPH]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[CPD-15104]][c] '''=>''' 1.0 [[1-KETO-2-METHYLVALERATE]][c] '''+''' 1.0 [[NADP]][c]
+
* [[1.6.5.4-RXN]]
* With common name(s):
+
== Reaction(s) known to produce the compound ==
** 1.0 NADPH[c] '''+''' 1.0 H+[c] '''+''' 1.0 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c] '''=>''' 1.0 (R)-2,3-dihydroxy-3-methylpentanoate[c] '''+''' 1.0 NADP+[c]
+
* [[RXN-10981]]
 
+
* [[RXN-3521]]
== Genes associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_10174]]
+
** [[pantograph]]-[[synechocystis]]
+
* [[Tiso_gene_10173]]
+
** [[pantograph]]-[[synechocystis]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-synechocystis]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=R289}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640]
{{#set: gene associated=Tiso_gene_10174|Tiso_gene_10173}}
+
* CHEBI:
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504]
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
{{#set: reconstruction source=orthology-synechocystis}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041]
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}}
 +
{{#set: common name=monodehydroascorbate radical}}
 +
{{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}}
 +
{{#set: molecular weight=175.118    }}
 +
{{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}}
 +
{{#set: consumed by=RXN-3523|1.6.5.4-RXN}}
 +
{{#set: produced by=RXN-10981|RXN-3521}}

Latest revision as of 20:04, 21 March 2018

Metabolite CPD-318

  • smiles:
    • C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
  • common name:
    • monodehydroascorbate radical
  • inchi key:
    • InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
  • molecular weight:
    • 175.118
  • Synonym(s):
    • monodehydroascorbic acid
    • semidehydroascorbic acid
    • semidehydroascorbate
    • ascorbyl radical

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)" cannot be used as a page name in this wiki.