Difference between revisions of "Tiso gene 15757"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=...")
(Created page with "Category:Gene == Gene Tiso_gene_15757 == * right end position: ** 4795 * transcription direction: ** NEGATIVE * left end position: ** 1224 * centisome position: ** 25.3994...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] ==
+
== Gene Tiso_gene_15757 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 4795
−
* common name:
+
* transcription direction:
−
** 3,8-divinyl chlorophyllide a
+
** NEGATIVE
−
* molecular weight:
+
* left end position:
−
** 610.951    
+
** 1224
 +
* centisome position:
 +
** 25.399462    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-5286]]
+
* Reaction: [[SUPEROX-DISMUT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-5285]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[DETOX1-PWY]]
 +
* [[PWY-6854]]
 +
* [[DETOX1-PWY-1]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4795}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927710 56927710]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=1224}}
−
** [http://www.chemspider.com/Chemical-Structure.391650.html 391650]
+
{{#set: centisome position=25.399462   }}
−
* CHEBI:
+
{{#set: reaction associated=SUPEROX-DISMUT-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38259 38259]
+
{{#set: pathway associated=DETOX1-PWY|PWY-6854|DETOX1-PWY-1}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11832 C11832]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=3,8-divinyl chlorophyllide a}}
+
−
{{#set: molecular weight=610.951   }}
+
−
{{#set: consumed by=RXN-5286}}
+
−
{{#set: produced by=RXN-5285}}
+

Latest revision as of 20:05, 21 March 2018

Gene Tiso_gene_15757

  • right end position:
    • 4795
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1224
  • centisome position:
    • 25.399462
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15757&oldid=45770"