Difference between revisions of "Tiso gene 11756"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_11756 == * Synonym(s): == Reactions associated == * Reaction: 1.4.3.19-RXN ** Source: orthology-synechocystis == Pathways associat...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11756 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.4.3.19-RXN]] | |
− | + | ** Source: [[orthology-synechocystis]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | * [[PWY-7396]] |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.4.3.19-RXN}} | |
− | + | {{#set: pathway associated=PWY-7396}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 20:06, 21 March 2018
Gene Tiso_gene_11756
- Synonym(s):
Reactions associated
- Reaction: 1.4.3.19-RXN
- Source: orthology-synechocystis