Difference between revisions of "2-phospho-ligated-tRNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10411 CPD-10411] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C(CC(O)2)=C(O)C=C(O)C=3))) * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-phospho-ligated-tRNA 2-phospho-ligated-tRNA] == * common name: ** a 2'-phospho-[ligated tRNA]...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-phospho-ligated-tRNA 2-phospho-ligated-tRNA] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 2'-phospho-[ligated tRNA] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 2 | + | ** a tRNA with a 2'-phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.7.1.160-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 2'-phospho-[ligated tRNA]}} | |
| − | + | {{#set: common name=a tRNA with a 2'-phosphate}} | |
| − | + | {{#set: consumed by=2.7.1.160-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name=2 | + | |
| − | {{#set: | + | |
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite 2-phospho-ligated-tRNA
- common name:
- a 2'-phospho-[ligated tRNA]
- Synonym(s):
- a tRNA with a 2'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a 2'-phospho-[ligated tRNA" cannot be used as a page name in this wiki.
