Difference between revisions of "RXN-9157"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=QDZNKMGEHAHO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9157 RXN-9157] == * direction: ** LEFT-TO-RIGHT * common name: ** gamma-glutamyl_transferase *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9157 RXN-9157] ==
* smiles:
+
* direction:
** CSCCCCCCC(=O)C([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 8-(methylthio)-2-oxooctanoate
+
** gamma-glutamyl_transferase
* molecular weight:
+
* ec number:
** 203.276   
+
** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2]
 
* Synonym(s):
 
* Synonym(s):
** 8-(methylthio)-2-oxooctanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-18205]]
+
** 1 [[CPD-9699]][c] '''+''' 1 [[GLUTATHIONE]][c] '''=>''' 1 [[CPD-9700]][c] '''+''' 1 [[CYS-GLY]][c]
* [[RXNQT-4171]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 hypoglycin A[c] '''+''' 1 glutathione[c] '''=>''' 1 hypoglycin B[c] '''+''' 1 L-cysteinyl-glycine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12321]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5826]], hypoglycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826]
 +
** '''4''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313]
+
{{#set: common name=gamma-glutamyl_transferase}}
* KNAPSACK : C00007643
+
{{#set: ec number=EC-2.3.2.2}}
{{#set: smiles=CSCCCCCCC(=O)C([O-])=O}}
+
{{#set: gene associated=Tiso_gene_12321}}
{{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}}
+
{{#set: in pathway=PWY-5826}}
{{#set: common name=8-(methylthio)-2-oxooctanoate}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: molecular weight=203.276    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
{{#set: common name=8-(methylthio)-2-oxooctanoic acid}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: produced by=RXN-18205|RXNQT-4171}}
+

Latest revision as of 21:08, 21 March 2018

Reaction RXN-9157

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • gamma-glutamyl_transferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 hypoglycin A[c] + 1 glutathione[c] => 1 hypoglycin B[c] + 1 L-cysteinyl-glycine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5826, hypoglycin biosynthesis: PWY-5826
    • 4 reactions found over 14 reactions in the full pathway

Reconstruction information

External links