Difference between revisions of "PWY-5033"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] == * smiles: ** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5033 PWY-5033] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5033 PWY-5033] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
* inchi key:
+
** InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J
+
 
* common name:
 
* common name:
** 6-cis, 3-oxo-tridecenoyl-CoA
+
** nicotinate degradation II
* molecular weight:
+
** 971.802   
+
 
* Synonym(s):
 
* Synonym(s):
** 6Z, 3-oxo-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14774]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-646]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_14341]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=MALEATE-ISOMERASE-RXN MALEATE-ISOMERASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11353 RXN-11353]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7585 RXN-7585]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7586 RXN-7586]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657308 90657308]
+
{{#set: common name=nicotinate degradation II}}
{{#set: smiles=CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J}}
+
{{#set: total reaction=5}}
{{#set: common name=6-cis, 3-oxo-tridecenoyl-CoA}}
+
{{#set: completion rate=20.0}}
{{#set: molecular weight=971.802    }}
+
{{#set: common name=6Z, 3-oxo-tridecenoyl-CoA}}
+
{{#set: consumed by=RXN-14774}}
+

Latest revision as of 19:30, 21 March 2018

Pathway PWY-5033

  • taxonomic range:
  • common name:
    • nicotinate degradation II
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links