Difference between revisions of "Tiso gene 15274"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == * smiles: ** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
(Created page with "Category:Gene == Gene Tiso_gene_15274 == * right end position: ** 2183 * transcription direction: ** POSITIVE * left end position: ** 963 * centisome position: ** 18.79757...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] ==
+
== Gene Tiso_gene_15274 ==
−
* smiles:
+
* right end position:
−
** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2183
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (E)-2-methylcrotonoyl-CoA
+
** 963
−
* molecular weight:
+
* centisome position:
−
** 845.604    
+
** 18.797579    
 
* Synonym(s):
 
* Synonym(s):
−
** methylcrotonyl-CoA
 
−
** trans-2-methylbut-2-enoyl-CoA
 
−
** 2-methylbut-2-enoyl-CoA
 
−
** tigloyl-CoA
 
−
** tiglyl-CoA
 
−
** 2-methyl-crotonyl-CoA
 
−
** (E)-2-methylbut-2-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
* [[MCDH_2mb2coa]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[TIGLYLCOA-HYDROXY-RXN]]
+
== Pathways associated ==
−
* [[RXN-14266]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 6247-62-7
+
{{#set: right end position=2183}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266534 45266534]
+
{{#set: left end position=963}}
−
* CHEBI:
+
{{#set: centisome position=18.797579   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15478 15478]
+
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03345 C03345]
+
−
* HMDB : HMDB02054
+
−
{{#set: smiles=CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J}}
+
−
{{#set: common name=(E)-2-methylcrotonoyl-CoA}}
+
−
{{#set: molecular weight=845.604   }}
+
−
{{#set: common name=methylcrotonyl-CoA|trans-2-methylbut-2-enoyl-CoA|2-methylbut-2-enoyl-CoA|tigloyl-CoA|tiglyl-CoA|2-methyl-crotonyl-CoA|(E)-2-methylbut-2-enoyl-CoA}}
+
−
{{#set: produced by=MCDH_2mb2coa}}
+
−
{{#set: reversible reaction associated=TIGLYLCOA-HYDROXY-RXN|RXN-14266}}
+

Latest revision as of 20:09, 21 March 2018

Gene Tiso_gene_15274

  • right end position:
    • 2183
  • transcription direction:
    • POSITIVE
  • left end position:
    • 963
  • centisome position:
    • 18.797579
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15274&oldid=46408"