Difference between revisions of "CPD-15104"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18857 == * left end position: ** 2 * transcription direction: ** POSITIVE * right end position: ** 1147 * centisome position: ** 7.25689350...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * common name: ** (R)-3-hydroxy-3-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC(O)(C)C(=O)C(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** (R)-3-hydroxy-3-methyl-2-oxopentanoate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 145.135 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[R05068]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14106]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20846131 20846131] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49257 49257] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463] |
| + | {{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}} | ||
| + | {{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}} | ||
| + | {{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}} | ||
| + | {{#set: molecular weight=145.135 }} | ||
| + | {{#set: consumed by=R05068}} | ||
| + | {{#set: reversible reaction associated=RXN-14106}} | ||
Latest revision as of 20:10, 21 March 2018
Contents
Metabolite CPD-15104
- smiles:
- CCC(O)(C)C(=O)C(=O)[O-]
- common name:
- (R)-3-hydroxy-3-methyl-2-oxopentanoate
- inchi key:
- InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
- molecular weight:
- 145.135
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(O)(C)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.
