Difference between revisions of "PRADP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRADP PRADP] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphoribosyl-ATP diphosphatase, c...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRADP PRADP] ==
−
* smiles:
+
* direction:
−
** CC(=O)C(O)COP(=O)([O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
+
 
* common name:
 
* common name:
−
** 1-deoxy-L-glycero-tetrulose 4-phosphate
+
** phosphoribosyl-ATP diphosphatase, cytosol
−
* molecular weight:
+
−
** 182.069   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-dihydroxy-2-butanone-4-phosphate
 
−
** tetrolose phosphate
 
−
** 3,4-dihydroxy-2-butanone-4-P
 
−
** L-3,4-dihydroxybutan-2-one-4-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[DIOHBUTANONEPSYN-RXN]]
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[PHOSPHORIBOSYL-ATP]][c] '''=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[PHOSPHORIBOSYL-AMP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 1-(5-phospho-β-D-ribosyl)-ATP[c] '''=>''' 1.0 diphosphate[c] '''+''' 1.0 H+[c] '''+''' 1.0 1-(5-phospho-β-D-ribosyl)-AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11297]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658385 90658385]
+
{{#set: common name=phosphoribosyl-ATP diphosphatase, cytosol}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_11297}}
−
** [http://www.chemspider.com/Chemical-Structure.10739351.html 10739351]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50606 50606]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* BIGG : db4p
+
{{#set: reconstruction tool=pantograph}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C15556 C15556]
+
−
{{#set: smiles=CC(=O)C(O)COP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L}}
+
−
{{#set: common name=1-deoxy-L-glycero-tetrulose 4-phosphate}}
+
−
{{#set: molecular weight=182.069    }}
+
−
{{#set: common name=3,4-dihydroxy-2-butanone-4-phosphate|tetrolose phosphate|3,4-dihydroxy-2-butanone-4-P|L-3,4-dihydroxybutan-2-one-4-phosphate}}
+
−
{{#set: produced by=DIOHBUTANONEPSYN-RXN}}
+

Latest revision as of 20:10, 21 March 2018

Reaction PRADP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phosphoribosyl-ATP diphosphatase, cytosol
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 1-(5-phospho-β-D-ribosyl)-ATP[c] => 1.0 diphosphate[c] + 1.0 H+[c] + 1.0 1-(5-phospho-β-D-ribosyl)-AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PRADP&oldid=46535"