Difference between revisions of "PRADP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRADP PRADP] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphoribosyl-ATP diphosphatase, c...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRADP PRADP] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phosphoribosyl-ATP diphosphatase, cytosol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[WATER]][c] '''+''' 1.0 [[PHOSPHORIBOSYL-ATP]][c] '''=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[PHOSPHORIBOSYL-AMP]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 H2O[c] '''+''' 1.0 1-(5-phospho-β-D-ribosyl)-ATP[c] '''=>''' 1.0 diphosphate[c] '''+''' 1.0 H+[c] '''+''' 1.0 1-(5-phospho-β-D-ribosyl)-AMP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11297]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=phosphoribosyl-ATP diphosphatase, cytosol}} | |
− | + | {{#set: gene associated=Tiso_gene_11297}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:10, 21 March 2018
Contents
Reaction PRADP
- direction:
- LEFT-TO-RIGHT
- common name:
- phosphoribosyl-ATP diphosphatase, cytosol
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 WATER[c] + 1.0 PHOSPHORIBOSYL-ATP[c] => 1.0 PPI[c] + 1.0 PROTON[c] + 1.0 PHOSPHORIBOSYL-AMP[c]
- With common name(s):
- 1.0 H2O[c] + 1.0 1-(5-phospho-β-D-ribosyl)-ATP[c] => 1.0 diphosphate[c] + 1.0 H+[c] + 1.0 1-(5-phospho-β-D-ribosyl)-AMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11297
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii