Difference between revisions of "NN-DIMETHYLANILINE-N-OXIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * inchi key: ** InChIKey=NU...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE-N-OXIDE NN-DIMETHYLANILINE-N-OXIDE] == * smiles: ** CN(C)(=O)C1(C=CC=CC=1) *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE-N-OXIDE NN-DIMETHYLANILINE-N-OXIDE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CN(C)(=O)C1(C=CC=CC=1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N,N-dimethylaniline-N-oxide |
+ | * inchi key: | ||
+ | ** InChIKey=LKQUDAOAMBKKQW-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 137.181 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.14.13.8-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=950 950] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.925.html 925] |
+ | * HMDB : HMDB01466 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17735 17735] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01183 C01183] |
− | {{#set: | + | {{#set: smiles=CN(C)(=O)C1(C=CC=CC=1)}} |
− | {{#set: | + | {{#set: common name=N,N-dimethylaniline-N-oxide}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=LKQUDAOAMBKKQW-UHFFFAOYSA-N}} |
− | + | {{#set: molecular weight=137.181 }} | |
− | + | {{#set: produced by=1.14.13.8-RXN}} | |
− | {{#set: produced by= | + |
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite NN-DIMETHYLANILINE-N-OXIDE
- smiles:
- CN(C)(=O)C1(C=CC=CC=1)
- common name:
- N,N-dimethylaniline-N-oxide
- inchi key:
- InChIKey=LKQUDAOAMBKKQW-UHFFFAOYSA-N
- molecular weight:
- 137.181
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links