Difference between revisions of "RXN-11598"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11598 RXN-11598] == * direction: ** LEFT-TO-RIGHT * common name: ** ribosomal_rnasmallsubunitme...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11598 RXN-11598] ==
* smiles:
+
* direction:
** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M
+
 
* common name:
 
* common name:
** triiodothyroacetate ester glucuronide
+
** ribosomal_rnasmallsubunitmethyltransferasee
* molecular weight:
+
* ec number:
** 797.054   
+
** [http://enzyme.expasy.org/EC/2.1.1.193 EC-2.1.1.193]
 
* Synonym(s):
 
* Synonym(s):
** triiodothyroacetic acid ester glucuronide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-10618]]
+
** 1 [[16S-rRNA-uracil1498]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[16S-rRNA-N3-methyluracil1498]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a uracil1498 in 16S rRNA[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 an N3-methyluracil1498 in 16S rRNA[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17244]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659348 90659348]
+
{{#set: common name=ribosomal_rnasmallsubunitmethyltransferasee}}
{{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))}}
+
{{#set: ec number=EC-2.1.1.193}}
{{#set: inchi key=InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M}}
+
{{#set: gene associated=Tiso_gene_17244}}
{{#set: common name=triiodothyroacetate ester glucuronide}}
+
{{#set: in pathway=}}
{{#set: molecular weight=797.054    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=triiodothyroacetic acid ester glucuronide}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
{{#set: produced by=RXN-10618}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:13, 21 March 2018

Reaction RXN-11598

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ribosomal_rnasmallsubunitmethyltransferasee
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links