Difference between revisions of "Cis-delta21-3-hydroxyC40-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta21-3-hydroxyC40-ACPs cis-delta21-3-hydroxyC40-ACPs] == * common name: ** a cis-delta21...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta21-3-hydroxyC40-ACPs cis-delta21-3-hydroxyC40-ACPs] ==
* smiles:
+
** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
+
* inchi key:
+
** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** bupropion
+
** a cis-delta21-3-hydroxyC40:1-[acp]
* molecular weight:
+
** 240.752   
+
 
* Synonym(s):
 
* Synonym(s):
** (-)-2-(tert-butylamino)-3'-chloropropiophenone
 
** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
 
** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
 
** amfebutamonum
 
** α-(tert-butylamino)-m-chloropropiophenone
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-181]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-287]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB01156
+
{{#set: common name=a cis-delta21-3-hydroxyC40:1-[acp]}}
* PUBCHEM:
+
{{#set: produced by=RXN1G-287}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860]
+
* HMDB : HMDB01510
+
{{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}}
+
{{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}}
+
{{#set: common name=bupropion}}
+
{{#set: molecular weight=240.752    }}
+
{{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}}
+
{{#set: consumed by=RXN66-181}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite cis-delta21-3-hydroxyC40-ACPs

  • common name:
    • a cis-delta21-3-hydroxyC40:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta21-3-hydroxyC40:1-[acp" cannot be used as a page name in this wiki.